C22H27N3O5S2 — CID 175798069
[4-(hydroxymethyl)phenyl]-[(2R)-2-[1-[(5-nitro-2-pyridinyl)disulfanyl]cyclohexyl]propyl]carbamic acid (PubChem CID 175798069) has the molecular formula C22H27N3O5S2 and a molecular weight of 477.61 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl]-[(2R)-2-[1-[(5-nitro-2-pyridinyl)disulfanyl]cyclohexyl]propyl]carbamic acid.
| Compound Name | [4-(hydroxymethyl)phenyl]-[(2R)-2-[1-[(5-nitro-2-pyridinyl)disulfanyl]cyclohexyl]propyl]carbamic acid |
|---|---|
| PubChem CID | 175798069 |
| Molecular Formula | C22H27N3O5S2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | [4-(hydroxymethyl)phenyl]-[(2R)-2-[1-[(5-nitro-2-pyridinyl)disulfanyl]cyclohexyl]propyl]carbamic acid |
| SMILES | C[C@H](CN(C(=O)O)c1ccc(CO)cc1)C1(SSc2ccc([N+](=O)[O-])cn2)CCCCC1 |
| InChI | InChI=1S/C22H27N3O5S2/c1-16(14-24(21(27)28)18-7-5-17(15-26)6-8-18)22(11-3-2-4-12-22)32-31-20-10-9-19(13-23-20)25(29)30/h5-10,13,16,26H,2-4,11-12,14-15H2,1H3,(H,27,28)/t16-/m1/s1 |
| InChIKey | QJGTXPUSFFOBPH-MRXNPFEDSA-N |
| XLogP | 5.75 |
| TPSA | 116.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|