C25H49N2+ — CID 175798459
1,1,5-tributyl-4-methyl-2-(4-methyloctan-4-yl)imidazol-1-ium (PubChem CID 175798459) has the molecular formula C25H49N2+ and a molecular weight of 377.68 g/mol. Its IUPAC name is 1,1,5-tributyl-4-methyl-2-(4-methyloctan-4-yl)imidazol-1-ium.
| Compound Name | 1,1,5-tributyl-4-methyl-2-(4-methyloctan-4-yl)imidazol-1-ium |
|---|---|
| PubChem CID | 175798459 |
| Molecular Formula | C25H49N2+ |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 377.39 |
| IUPAC Name | 1,1,5-tributyl-4-methyl-2-(4-methyloctan-4-yl)imidazol-1-ium |
| SMILES | CCCCC1=C(C)N=C(C(C)(CCC)CCCC)[N+]1(CCCC)CCCC |
| InChI | InChI=1S/C25H49N2/c1-8-13-17-23-22(6)26-24(25(7,18-12-5)19-14-9-2)27(23,20-15-10-3)21-16-11-4/h8-21H2,1-7H3/q+1 |
| InChIKey | DACJMUPBIXAJOH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|