C18H35N2+ — CID 175301780
1,5-dibutyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium (PubChem CID 175301780) has the molecular formula C18H35N2+ and a molecular weight of 279.49 g/mol. Its IUPAC name is 1,5-dibutyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium.
| Compound Name | 1,5-dibutyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium |
|---|---|
| PubChem CID | 175301780 |
| Molecular Formula | C18H35N2+ |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.28 |
| IUPAC Name | 1,5-dibutyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium |
| SMILES | CCCCC1=C(CCC(C)C)N=C(C)[N+]1(C)CCCC |
| InChI | InChI=1S/C18H35N2/c1-7-9-11-18-17(13-12-15(3)4)19-16(5)20(18,6)14-10-8-2/h15H,7-14H2,1-6H3/q+1 |
| InChIKey | XARIHSDTYKHARH-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|