C16H31N2+ — CID 175301786
5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium (PubChem CID 175301786) has the molecular formula C16H31N2+ and a molecular weight of 251.44 g/mol. Its IUPAC name is 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium.
| Compound Name | 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium |
|---|---|
| PubChem CID | 175301786 |
| Molecular Formula | C16H31N2+ |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 251.25 |
| IUPAC Name | 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium |
| SMILES | CCCCC1=C(CCC(C)C)N=C(C)[N+]1(C)CC |
| InChI | InChI=1S/C16H31N2/c1-7-9-10-16-15(12-11-13(3)4)17-14(5)18(16,6)8-2/h13H,7-12H2,1-6H3/q+1 |
| InChIKey | IXPWQFLQVMSGQJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|