C28H50N4O3S — CID 175801989
20-[(4-methylpiperazin-1-yl)methyl]-10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane (PubChem CID 175801989) has the molecular formula C28H50N4O3S and a molecular weight of 522.80 g/mol. Its IUPAC name is 20-[(4-methylpiperazin-1-yl)methyl]-10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane.
| Compound Name | 20-[(4-methylpiperazin-1-yl)methyl]-10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane |
|---|---|
| PubChem CID | 175801989 |
| Molecular Formula | C28H50N4O3S |
| Molecular Weight | 522.80 g/mol |
| Exact Mass | 522.36 |
| IUPAC Name | 20-[(4-methylpiperazin-1-yl)methyl]-10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane |
| SMILES | CN1CCN(CC2COC3CCCC(CCOC4NSC5CNCC(C6CCC(CC6)O2)C45)C3)CC1 |
| InChI | InChI=1S/C28H50N4O3S/c1-31-10-12-32(13-11-31)18-24-19-34-23-4-2-3-20(15-23)9-14-33-28-27-25(16-29-17-26(27)36-30-28)21-5-7-22(35-24)8-6-21/h20-30H,2-19H2,1H3 |
| InChIKey | OBYBUAZMKZWJLQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.80 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|