C22H38N2O3S — CID 175801923
10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane (PubChem CID 175801923) has the molecular formula C22H38N2O3S and a molecular weight of 410.62 g/mol. Its IUPAC name is 10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane.
| Compound Name | 10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane |
|---|---|
| PubChem CID | 175801923 |
| Molecular Formula | C22H38N2O3S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 10,18,21-trioxa-7-thia-4,8-diazapentacyclo[20.2.2.12,6.113,17.09,28]octacosane |
| SMILES | C1CC2CCOC3NSC4CNCC(C5CCC(CC5)OCCOC(C1)C2)C34 |
| InChI | InChI=1S/C22H38N2O3S/c1-2-15-8-9-27-22-21-19(13-23-14-20(21)28-24-22)16-4-6-17(7-5-16)25-10-11-26-18(3-1)12-15/h15-24H,1-14H2 |
| InChIKey | JXWKSATUQZTORX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|