C24H23Cl2FN6O3 — CID 175805948
2,6-dichloro-8-fluoro-5-[2-[[(1R)-1-[4-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]ethyl]amino]ethoxy]-3H-quinazolin-4-one (PubChem CID 175805948) has the molecular formula C24H23Cl2FN6O3 and a molecular weight of 533.39 g/mol. Its IUPAC name is 2,6-dichloro-8-fluoro-5-[2-[[(1R)-1-[4-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]ethyl]amino]ethoxy]-3H-quinazolin-4-one.
| Compound Name | 2,6-dichloro-8-fluoro-5-[2-[[(1R)-1-[4-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]ethyl]amino]ethoxy]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 175805948 |
| Molecular Formula | C24H23Cl2FN6O3 |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 2,6-dichloro-8-fluoro-5-[2-[[(1R)-1-[4-[(4-methoxyphenyl)methylamino]pyrimidin-5-yl]ethyl]amino]ethoxy]-3H-quinazolin-4-one |
| SMILES | COc1ccc(CNc2ncncc2[C@@H](C)NCCOc2c(Cl)cc(F)c3nc(Cl)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C24H23Cl2FN6O3/c1-13(16-11-28-12-31-22(16)30-10-14-3-5-15(35-2)6-4-14)29-7-8-36-21-17(25)9-18(27)20-19(21)23(34)33-24(26)32-20/h3-6,9,11-13,29H,7-8,10H2,1-2H3,(H,28,30,31)(H,32,33,34)/t13-/m1/s1 |
| InChIKey | NQEUURXZKJNCTL-CYBMUJFWSA-N |
| XLogP | 4.51 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|