C56H89NO4S — CID 175805996
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 175805996) has the molecular formula C56H89NO4S and a molecular weight of 872.40 g/mol. Its IUPAC name is (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 175805996 |
| Molecular Formula | C56H89NO4S |
| Molecular Weight | 872.40 g/mol |
| Exact Mass | 871.65 |
| IUPAC Name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl-[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCC/C=C\CCCCCCCC)N(C(=O)OCC1c2ccccc2-c2ccccc21)[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C56H89NO4S/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-40-48(39-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2)57(54(55(58)59)45-46-62-3)56(60)61-47-53-51-43-37-35-41-49(51)50-42-36-38-44-52(50)53/h18-21,35-38,41-44,48,53-54H,4-17,22-34,39-40,45-47H2,1-3H3,(H,58,59)/b20-18-,21-19-/t48?,54-/m0/s1 |
| InChIKey | BLVPTIRFVOUYKD-YXLDPFCJSA-N |
| XLogP | 17.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.40 |
| LogP ≤ 5 | 17.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|