C14H13FN4O2S — CID 175807758
N-[2-fluoro-6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]ethanesulfonamide (PubChem CID 175807758) has the molecular formula C14H13FN4O2S and a molecular weight of 320.35 g/mol. Its IUPAC name is N-[2-fluoro-6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]ethanesulfonamide.
| Compound Name | N-[2-fluoro-6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 175807758 |
| Molecular Formula | C14H13FN4O2S |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[2-fluoro-6-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-pyridinyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(-c2ccnc3[nH]ccc23)nc1F |
| InChI | InChI=1S/C14H13FN4O2S/c1-2-22(20,21)19-12-4-3-11(18-13(12)15)9-5-7-16-14-10(9)6-8-17-14/h3-8,19H,2H2,1H3,(H,16,17) |
| InChIKey | VTWYSFIXEYOBMH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|