C17H14ClNOS — CID 175814201
4-chloro-11-ethyl-2H-pyrano[2,3-b]phenothiazine (PubChem CID 175814201) has the molecular formula C17H14ClNOS and a molecular weight of 315.83 g/mol. Its IUPAC name is 4-chloro-11-ethyl-2H-pyrano[2,3-b]phenothiazine.
| Compound Name | 4-chloro-11-ethyl-2H-pyrano[2,3-b]phenothiazine |
|---|---|
| PubChem CID | 175814201 |
| Molecular Formula | C17H14ClNOS |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-chloro-11-ethyl-2H-pyrano[2,3-b]phenothiazine |
| SMILES | CCN1c2ccccc2Sc2cc3c(cc21)OCC=C3Cl |
| InChI | InChI=1S/C17H14ClNOS/c1-2-19-13-5-3-4-6-16(13)21-17-9-11-12(18)7-8-20-15(11)10-14(17)19/h3-7,9-10H,2,8H2,1H3 |
| InChIKey | CYQCEIYODWSEKK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |