C21H25N5O5 — CID 175819386
2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-methyl-2-piperazin-1-ylpropanamide (PubChem CID 175819386) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-methyl-2-piperazin-1-ylpropanamide.
| Compound Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-methyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 175819386 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-methyl-2-piperazin-1-ylpropanamide |
| SMILES | CNC(=O)C(C)(c1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)N1CCNCC1 |
| InChI | InChI=1S/C21H25N5O5/c1-21(20(31)22-2,25-9-7-23-8-10-25)12-3-4-13-14(11-12)19(30)26(18(13)29)15-5-6-16(27)24-17(15)28/h3-4,11,15,23H,5-10H2,1-2H3,(H,22,31)(H,24,27,28) |
| InChIKey | CQNXBAOVMOEKOF-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|