About 1-deuterio-4-(2,4-difluorophenyl)piperazine
1-deuterio-4-(2,4-difluorophenyl)piperazine (PubChem CID 175828610) has the molecular formula C10H12F2N2
and a molecular weight of 199.22 g/mol. Its IUPAC name is 1-deuterio-4-(2,4-difluorophenyl)piperazine.
Molecular Properties
| Compound Name | 1-deuterio-4-(2,4-difluorophenyl)piperazine |
| PubChem CID | 175828610 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-deuterio-4-(2,4-difluorophenyl)piperazine |
| SMILES | [2H]N1CCN(c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C10H12F2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2/i/hD |
| InChIKey | CMCSPBOWEYUGHB-DYCDLGHISA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-deuterio-4-(2,4-difluorophenyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-4-(2,4-difluorophenyl)piperazine?
The IUPAC name of 1-deuterio-4-(2,4-difluorophenyl)piperazine (CID 175828610) is 1-deuterio-4-(2,4-difluorophenyl)piperazine.
What is the SMILES notation for 1-deuterio-4-(2,4-difluorophenyl)piperazine?
The canonical SMILES for 1-deuterio-4-(2,4-difluorophenyl)piperazine is [2H]N1CCN(c2ccc(F)cc2F)CC1.
What is the InChIKey of 1-deuterio-4-(2,4-difluorophenyl)piperazine?
The InChIKey is CMCSPBOWEYUGHB-DYCDLGHISA-N. The full InChI is InChI=1S/C10H12F2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2/i/hD.
What are the key properties of 1-deuterio-4-(2,4-difluorophenyl)piperazine?
1-deuterio-4-(2,4-difluorophenyl)piperazine has a molecular weight of 199.22 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-4-(2,4-difluorophenyl)piperazine is sourced from PubChem (CID 175828610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).