C10H13F2N2+ — CID 7004236
1-(2,4-difluorophenyl)piperazin-4-ium (PubChem CID 7004236) has the molecular formula C10H13F2N2+ and a molecular weight of 199.22 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)piperazin-4-ium.
| Compound Name | 1-(2,4-difluorophenyl)piperazin-4-ium |
|---|---|
| PubChem CID | 7004236 |
| Molecular Formula | C10H13F2N2+ |
| Molecular Weight | 199.22 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(2,4-difluorophenyl)piperazin-4-ium |
| SMILES | Fc1ccc(N2CC[NH2+]CC2)c(F)c1 |
| InChI | InChI=1S/C10H12F2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2/p+1 |
| InChIKey | CMCSPBOWEYUGHB-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 19.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |