About 1-deuterio-1,3-dihydroxypropan-2-one
1-deuterio-1,3-dihydroxypropan-2-one (PubChem CID 175831178) has the molecular formula C3H6O3
and a molecular weight of 91.08 g/mol. Its IUPAC name is 1-deuterio-1,3-dihydroxypropan-2-one.
Molecular Properties
| Compound Name | 1-deuterio-1,3-dihydroxypropan-2-one |
| PubChem CID | 175831178 |
| Molecular Formula | C3H6O3 |
| Molecular Weight | 91.08 g/mol |
| Exact Mass | 91.04 |
| IUPAC Name | 1-deuterio-1,3-dihydroxypropan-2-one |
| SMILES | [2H]C(O)C(=O)CO |
| InChI | InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2/i1D |
| InChIKey | RXKJFZQQPQGTFL-MICDWDOJSA-N |
| XLogP | -1.46 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.08 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-deuterio-1,3-dihydroxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-deuterio-1,3-dihydroxypropan-2-one?
The IUPAC name of 1-deuterio-1,3-dihydroxypropan-2-one (CID 175831178) is 1-deuterio-1,3-dihydroxypropan-2-one.
What is the SMILES notation for 1-deuterio-1,3-dihydroxypropan-2-one?
The canonical SMILES for 1-deuterio-1,3-dihydroxypropan-2-one is [2H]C(O)C(=O)CO.
What is the InChIKey of 1-deuterio-1,3-dihydroxypropan-2-one?
The InChIKey is RXKJFZQQPQGTFL-MICDWDOJSA-N. The full InChI is InChI=1S/C3H6O3/c4-1-3(6)2-5/h4-5H,1-2H2/i1D.
What are the key properties of 1-deuterio-1,3-dihydroxypropan-2-one?
1-deuterio-1,3-dihydroxypropan-2-one has a molecular weight of 91.08 g/mol, XLogP of -1.46, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-deuterio-1,3-dihydroxypropan-2-one is sourced from PubChem (CID 175831178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).