C46H76O4 — CID 175832521
1,4-bis(3,4-dioctyl-2H-pyran-2-yl)but-2-ene-1,4-dione (PubChem CID 175832521) has the molecular formula C46H76O4 and a molecular weight of 693.11 g/mol. Its IUPAC name is 1,4-bis(3,4-dioctyl-2H-pyran-2-yl)but-2-ene-1,4-dione.
| Compound Name | 1,4-bis(3,4-dioctyl-2H-pyran-2-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 175832521 |
| Molecular Formula | C46H76O4 |
| Molecular Weight | 693.11 g/mol |
| Exact Mass | 692.57 |
| IUPAC Name | 1,4-bis(3,4-dioctyl-2H-pyran-2-yl)but-2-ene-1,4-dione |
| SMILES | CCCCCCCCC1=C(CCCCCCCC)C(C(=O)C=CC(=O)C2OC=CC(CCCCCCCC)=C2CCCCCCCC)OC=C1 |
| InChI | InChI=1S/C46H76O4/c1-5-9-13-17-21-25-29-39-35-37-49-45(41(39)31-27-23-19-15-11-7-3)43(47)33-34-44(48)46-42(32-28-24-20-16-12-8-4)40(36-38-50-46)30-26-22-18-14-10-6-2/h33-38,45-46H,5-32H2,1-4H3 |
| InChIKey | YPPHELBSOIMFCG-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.11 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|