About 4-hydroxy-2,3-dioxohexanal
4-hydroxy-2,3-dioxohexanal (PubChem CID 175835791) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is 4-hydroxy-2,3-dioxohexanal.
Molecular Properties
| Compound Name | 4-hydroxy-2,3-dioxohexanal |
| PubChem CID | 175835791 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 4-hydroxy-2,3-dioxohexanal |
| SMILES | CCC(O)C(=O)C(=O)C=O |
| InChI | InChI=1S/C6H8O4/c1-2-4(8)6(10)5(9)3-7/h3-4,8H,2H2,1H3 |
| InChIKey | AUEVGENTVYSFOK-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-2,3-dioxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,3-dioxohexanal?
The IUPAC name of 4-hydroxy-2,3-dioxohexanal (CID 175835791) is 4-hydroxy-2,3-dioxohexanal.
What is the SMILES notation for 4-hydroxy-2,3-dioxohexanal?
The canonical SMILES for 4-hydroxy-2,3-dioxohexanal is CCC(O)C(=O)C(=O)C=O.
What is the InChIKey of 4-hydroxy-2,3-dioxohexanal?
The InChIKey is AUEVGENTVYSFOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O4/c1-2-4(8)6(10)5(9)3-7/h3-4,8H,2H2,1H3.
What are the key properties of 4-hydroxy-2,3-dioxohexanal?
4-hydroxy-2,3-dioxohexanal has a molecular weight of 144.13 g/mol, XLogP of -0.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dioxohexanal is sourced from PubChem (CID 175835791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).