C26H21N4O2+ — CID 175842216
2-benzyl-6-[2-(4-hydroxyphenyl)ethenyl]-8-pyridin-2-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 175842216) has the molecular formula C26H21N4O2+ and a molecular weight of 421.48 g/mol. Its IUPAC name is 2-benzyl-6-[2-(4-hydroxyphenyl)ethenyl]-8-pyridin-2-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 2-benzyl-6-[2-(4-hydroxyphenyl)ethenyl]-8-pyridin-2-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 175842216 |
| Molecular Formula | C26H21N4O2+ |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-benzyl-6-[2-(4-hydroxyphenyl)ethenyl]-8-pyridin-2-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | O=C1C(Cc2ccccc2)Nc2c(-c3ccccn3)nc(C=Cc3ccc(O)cc3)c[n+]21 |
| InChI | InChI=1S/C26H20N4O2/c31-21-13-10-18(11-14-21)9-12-20-17-30-25(24(28-20)22-8-4-5-15-27-22)29-23(26(30)32)16-19-6-2-1-3-7-19/h1-15,17,23,31H,16H2/p+1 |
| InChIKey | FIJUFMWKDSCPCY-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|