C30H24N3O2+ — CID 136611625
8-benzyl-6-(4-hydroxyphenyl)-2-(naphthalen-2-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 136611625) has the molecular formula C30H24N3O2+ and a molecular weight of 458.54 g/mol. Its IUPAC name is 8-benzyl-6-(4-hydroxyphenyl)-2-(naphthalen-2-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 8-benzyl-6-(4-hydroxyphenyl)-2-(naphthalen-2-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 136611625 |
| Molecular Formula | C30H24N3O2+ |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 8-benzyl-6-(4-hydroxyphenyl)-2-(naphthalen-2-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | O=C1C(Cc2ccc3ccccc3c2)Nc2c(Cc3ccccc3)nc(-c3ccc(O)cc3)c[n+]21 |
| InChI | InChI=1S/C30H23N3O2/c34-25-14-12-23(13-15-25)28-19-33-29(26(31-28)17-20-6-2-1-3-7-20)32-27(30(33)35)18-21-10-11-22-8-4-5-9-24(22)16-21/h1-16,19,27,34H,17-18H2/p+1 |
| InChIKey | UJRAMMDUKPTSDV-UHFFFAOYSA-O |
| XLogP | 5.16 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|