C33H36ClN4O+ — CID 174083732
8-benzyl-2-[[3-chloro-4-(heptylamino)phenyl]methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 174083732) has the molecular formula C33H36ClN4O+ and a molecular weight of 540.13 g/mol. Its IUPAC name is 8-benzyl-2-[[3-chloro-4-(heptylamino)phenyl]methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 8-benzyl-2-[[3-chloro-4-(heptylamino)phenyl]methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 174083732 |
| Molecular Formula | C33H36ClN4O+ |
| Molecular Weight | 540.13 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 8-benzyl-2-[[3-chloro-4-(heptylamino)phenyl]methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | CCCCCCCNc1ccc(CC2Nc3c(Cc4ccccc4)nc(-c4ccccc4)c[n+]3C2=O)cc1Cl |
| InChI | InChI=1S/C33H35ClN4O/c1-2-3-4-5-12-19-35-28-18-17-25(20-27(28)34)22-30-33(39)38-23-31(26-15-10-7-11-16-26)36-29(32(38)37-30)21-24-13-8-6-9-14-24/h6-11,13-18,20,23,30,35H,2-5,12,19,21-22H2,1H3/p+1 |
| InChIKey | IVQDBILNJRHDOJ-UHFFFAOYSA-O |
| XLogP | 7.34 |
| TPSA | 57.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.13 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|