C36H40N3O3S+ — CID 174083661
O-tert-butyl 6-[3-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]phenoxy]hexanethioate (PubChem CID 174083661) has the molecular formula C36H40N3O3S+ and a molecular weight of 594.80 g/mol. Its IUPAC name is O-tert-butyl 6-[3-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]phenoxy]hexanethioate.
| Compound Name | O-tert-butyl 6-[3-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]phenoxy]hexanethioate |
|---|---|
| PubChem CID | 174083661 |
| Molecular Formula | C36H40N3O3S+ |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | O-tert-butyl 6-[3-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]phenoxy]hexanethioate |
| SMILES | CC(C)(C)OC(=S)CCCCCOc1cccc(CC2Nc3c(Cc4ccccc4)nc(-c4ccccc4)c[n+]3C2=O)c1 |
| InChI | InChI=1S/C36H39N3O3S/c1-36(2,3)42-33(43)20-11-6-12-21-41-29-19-13-16-27(22-29)24-31-35(40)39-25-32(28-17-9-5-10-18-28)37-30(34(39)38-31)23-26-14-7-4-8-15-26/h4-5,7-10,13-19,22,25,31H,6,11-12,20-21,23-24H2,1-3H3/p+1 |
| InChIKey | ZHRSEAOLXGFTAV-UHFFFAOYSA-O |
| XLogP | 7.39 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|