C26H24N3O+ — CID 174045059
2,8-dibenzyl-6-cyclohexa-1,5-dien-1-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 174045059) has the molecular formula C26H24N3O+ and a molecular weight of 394.50 g/mol. Its IUPAC name is 2,8-dibenzyl-6-cyclohexa-1,5-dien-1-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 2,8-dibenzyl-6-cyclohexa-1,5-dien-1-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 174045059 |
| Molecular Formula | C26H24N3O+ |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 2,8-dibenzyl-6-cyclohexa-1,5-dien-1-yl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | O=C1C(Cc2ccccc2)Nc2c(Cc3ccccc3)nc(C3=CCCC=C3)c[n+]21 |
| InChI | InChI=1S/C26H23N3O/c30-26-23(17-20-12-6-2-7-13-20)28-25-22(16-19-10-4-1-5-11-19)27-24(18-29(25)26)21-14-8-3-9-15-21/h1-2,4-8,10-15,18,23H,3,9,16-17H2/p+1 |
| InChIKey | YVUOJTHWXFTDHO-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 45.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|