About 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one
8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 167599934) has the molecular formula C25H21N4O+
and a molecular weight of 393.47 g/mol. Its IUPAC name is 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
Molecular Properties
| Compound Name | 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| PubChem CID | 167599934 |
| Molecular Formula | C25H21N4O+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | O=C1C(Cc2ccncc2)Nc2c(Cc3ccccc3)nc(-c3ccccc3)c[n+]21 |
| InChI | InChI=1S/C25H20N4O/c30-25-22(16-19-11-13-26-14-12-19)28-24-21(15-18-7-3-1-4-8-18)27-23(17-29(24)25)20-9-5-2-6-10-20/h1-14,17,22H,15-16H2/p+1 |
| InChIKey | PEXWEIPIGBCBAY-UHFFFAOYSA-O |
| XLogP | 3.70 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one?
The IUPAC name of 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (CID 167599934) is 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
What is the SMILES notation for 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one?
The canonical SMILES for 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one is O=C1C(Cc2ccncc2)Nc2c(Cc3ccccc3)nc(-c3ccccc3)c[n+]21.
What is the InChIKey of 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one?
The InChIKey is PEXWEIPIGBCBAY-UHFFFAOYSA-O. The full InChI is InChI=1S/C25H20N4O/c30-25-22(16-19-11-13-26-14-12-19)28-24-21(15-18-7-3-1-4-8-18)27-23(17-29(24)25)20-9-5-2-6-10-20/h1-14,17,22H,15-16H2/p+1.
What are the key properties of 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one?
8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one has a molecular weight of 393.47 g/mol, XLogP of 3.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-benzyl-6-phenyl-2-(pyridin-4-ylmethyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one is sourced from PubChem (CID 167599934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).