C23H20N5O+ — CID 152751634
8-benzyl-2-(1H-imidazol-2-ylmethyl)-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 152751634) has the molecular formula C23H20N5O+ and a molecular weight of 382.45 g/mol. Its IUPAC name is 8-benzyl-2-(1H-imidazol-2-ylmethyl)-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 8-benzyl-2-(1H-imidazol-2-ylmethyl)-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 152751634 |
| Molecular Formula | C23H20N5O+ |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 8-benzyl-2-(1H-imidazol-2-ylmethyl)-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | O=C1C(Cc2ncc[nH]2)Nc2c(Cc3ccccc3)nc(-c3ccccc3)c[n+]21 |
| InChI | InChI=1S/C23H19N5O/c29-23-19(14-21-24-11-12-25-21)27-22-18(13-16-7-3-1-4-8-16)26-20(15-28(22)23)17-9-5-2-6-10-17/h1-12,15,19H,13-14H2,(H,24,25)/p+1 |
| InChIKey | JDMHLPUDUUFGDU-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|