C25H20N3O3+ — CID 174083867
4-[8-benzyl-2-(furan-2-ylmethyl)-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl]benzaldehyde (PubChem CID 174083867) has the molecular formula C25H20N3O3+ and a molecular weight of 410.45 g/mol. Its IUPAC name is 4-[8-benzyl-2-(furan-2-ylmethyl)-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl]benzaldehyde.
| Compound Name | 4-[8-benzyl-2-(furan-2-ylmethyl)-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl]benzaldehyde |
|---|---|
| PubChem CID | 174083867 |
| Molecular Formula | C25H20N3O3+ |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 4-[8-benzyl-2-(furan-2-ylmethyl)-3-oxo-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-6-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2c[n+]3c(c(Cc4ccccc4)n2)NC(Cc2ccco2)C3=O)cc1 |
| InChI | InChI=1S/C25H19N3O3/c29-16-18-8-10-19(11-9-18)23-15-28-24(21(26-23)13-17-5-2-1-3-6-17)27-22(25(28)30)14-20-7-4-12-31-20/h1-12,15-16,22H,13-14H2/p+1 |
| InChIKey | VZFYGWMLODQBNK-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 76.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|