C25H20F2N3O2+ — CID 154039847
8-[(2,3-difluorophenyl)methyl]-2-[(5-methylfuran-2-yl)methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 154039847) has the molecular formula C25H20F2N3O2+ and a molecular weight of 432.45 g/mol. Its IUPAC name is 8-[(2,3-difluorophenyl)methyl]-2-[(5-methylfuran-2-yl)methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 8-[(2,3-difluorophenyl)methyl]-2-[(5-methylfuran-2-yl)methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 154039847 |
| Molecular Formula | C25H20F2N3O2+ |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 8-[(2,3-difluorophenyl)methyl]-2-[(5-methylfuran-2-yl)methyl]-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | Cc1ccc(CC2Nc3c(Cc4cccc(F)c4F)nc(-c4ccccc4)c[n+]3C2=O)o1 |
| InChI | InChI=1S/C25H19F2N3O2/c1-15-10-11-18(32-15)13-21-25(31)30-14-22(16-6-3-2-4-7-16)28-20(24(30)29-21)12-17-8-5-9-19(26)23(17)27/h2-11,14,21H,12-13H2,1H3/p+1 |
| InChIKey | YWXVICJOASGWED-UHFFFAOYSA-O |
| XLogP | 4.48 |
| TPSA | 59.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|