C29H28N3O2+ — CID 174082091
8-benzyl-2-[[3-(methoxymethyl)phenyl]methyl]-6-(3-methylphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 174082091) has the molecular formula C29H28N3O2+ and a molecular weight of 450.56 g/mol. Its IUPAC name is 8-benzyl-2-[[3-(methoxymethyl)phenyl]methyl]-6-(3-methylphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 8-benzyl-2-[[3-(methoxymethyl)phenyl]methyl]-6-(3-methylphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 174082091 |
| Molecular Formula | C29H28N3O2+ |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 8-benzyl-2-[[3-(methoxymethyl)phenyl]methyl]-6-(3-methylphenyl)-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | COCc1cccc(CC2Nc3c(Cc4ccccc4)nc(-c4cccc(C)c4)c[n+]3C2=O)c1 |
| InChI | InChI=1S/C29H27N3O2/c1-20-8-6-13-24(14-20)27-18-32-28(25(30-27)16-21-9-4-3-5-10-21)31-26(29(32)33)17-22-11-7-12-23(15-22)19-34-2/h3-15,18,26H,16-17,19H2,1-2H3/p+1 |
| InChIKey | CQDJMGZFKVZFKH-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|