C32H31ClN3O4+ — CID 154024306
6-[4-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]-2-chlorophenoxy]hexanoic acid (PubChem CID 154024306) has the molecular formula C32H31ClN3O4+ and a molecular weight of 557.07 g/mol. Its IUPAC name is 6-[4-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]-2-chlorophenoxy]hexanoic acid.
| Compound Name | 6-[4-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]-2-chlorophenoxy]hexanoic acid |
|---|---|
| PubChem CID | 154024306 |
| Molecular Formula | C32H31ClN3O4+ |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 6-[4-[(8-benzyl-3-oxo-6-phenyl-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-2-yl)methyl]-2-chlorophenoxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1ccc(CC2Nc3c(Cc4ccccc4)nc(-c4ccccc4)c[n+]3C2=O)cc1Cl |
| InChI | InChI=1S/C32H30ClN3O4/c33-25-18-23(15-16-29(25)40-17-9-3-8-14-30(37)38)20-27-32(39)36-21-28(24-12-6-2-7-13-24)34-26(31(36)35-27)19-22-10-4-1-5-11-22/h1-2,4-7,10-13,15-16,18,21,27H,3,8-9,14,17,19-20H2,(H,37,38)/p+1 |
| InChIKey | FTWBZTBREUKFPG-UHFFFAOYSA-O |
| XLogP | 5.98 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|