C21H18N3O+ — CID 174057534
2-benzyl-6-[(E)-2-phenylethenyl]-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one (PubChem CID 174057534) has the molecular formula C21H18N3O+ and a molecular weight of 328.40 g/mol. Its IUPAC name is 2-benzyl-6-[(E)-2-phenylethenyl]-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one.
| Compound Name | 2-benzyl-6-[(E)-2-phenylethenyl]-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
|---|---|
| PubChem CID | 174057534 |
| Molecular Formula | C21H18N3O+ |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-benzyl-6-[(E)-2-phenylethenyl]-1,2-dihydroimidazo[1,2-a]pyrazin-4-ium-3-one |
| SMILES | O=C1C(Cc2ccccc2)Nc2cnc(/C=C/c3ccccc3)c[n+]21 |
| InChI | InChI=1S/C21H17N3O/c25-21-19(13-17-9-5-2-6-10-17)23-20-14-22-18(15-24(20)21)12-11-16-7-3-1-4-8-16/h1-12,14-15,19H,13H2/p+1/b12-11+ |
| InChIKey | QRZQRFKZMNRYSU-VAWYXSNFSA-O |
| XLogP | 3.22 |
| TPSA | 45.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|