C17H21BF3N3O2 — CID 175843039
6-[(2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,5-b]pyridine (PubChem CID 175843039) has the molecular formula C17H21BF3N3O2 and a molecular weight of 367.18 g/mol. Its IUPAC name is 6-[(2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,5-b]pyridine.
| Compound Name | 6-[(2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 175843039 |
| Molecular Formula | C17H21BF3N3O2 |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 6-[(2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-1-(2,2,2-trifluoroethyl)pyrazolo[4,5-b]pyridine |
| SMILES | CC1(C)OB([C@H]2CC2c2cnc3cnn(CC(F)(F)F)c3c2)OC1(C)C |
| InChI | InChI=1S/C17H21BF3N3O2/c1-15(2)16(3,4)26-18(25-15)12-6-11(12)10-5-14-13(22-7-10)8-23-24(14)9-17(19,20)21/h5,7-8,11-12H,6,9H2,1-4H3/t11?,12-/m0/s1 |
| InChIKey | MVOIVYAQTDXJPD-KIYNQFGBSA-N |
| XLogP | 3.94 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|