C14H13N3O4 — CID 175848526
4-deuterio-2-(2,6-dioxopiperidin-3-yl)-6-(methylamino)isoindole-1,3-dione (PubChem CID 175848526) has the molecular formula C14H13N3O4 and a molecular weight of 288.28 g/mol. Its IUPAC name is 4-deuterio-2-(2,6-dioxopiperidin-3-yl)-6-(methylamino)isoindole-1,3-dione.
| Compound Name | 4-deuterio-2-(2,6-dioxopiperidin-3-yl)-6-(methylamino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175848526 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-deuterio-2-(2,6-dioxopiperidin-3-yl)-6-(methylamino)isoindole-1,3-dione |
| SMILES | [2H]c1cc(NC)cc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H13N3O4/c1-15-7-2-3-8-9(6-7)14(21)17(13(8)20)10-4-5-11(18)16-12(10)19/h2-3,6,10,15H,4-5H2,1H3,(H,16,18,19)/i3D |
| InChIKey | ANWNNDZLXKBUIN-WFVSFCRTSA-N |
| XLogP | 0.13 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|