C17H20N2O2 — CID 175863438
methyl (3R,12R)-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10-tetraene-13-carboxylate (PubChem CID 175863438) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is methyl (3R,12R)-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10-tetraene-13-carboxylate.
| Compound Name | methyl (3R,12R)-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10-tetraene-13-carboxylate |
|---|---|
| PubChem CID | 175863438 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | methyl (3R,12R)-2-methyl-6,11-diazatetracyclo[6.6.1.13,12.05,15]hexadeca-1(15),5,8,10-tetraene-13-carboxylate |
| SMILES | COC(=O)C1CC2=C3C4=C/C=N\[C@@H]1C[C@H](CC3=NC4)C2C |
| InChI | InChI=1S/C17H20N2O2/c1-9-11-5-14-13(17(20)21-2)7-12(9)16-10(3-4-18-14)8-19-15(16)6-11/h3-4,9,11,13-14H,5-8H2,1-2H3/b10-3?,18-4-/t9?,11-,13?,14-/m1/s1 |
| InChIKey | UKMJJUVZHAASIH-PBLBIZRWSA-N |
| XLogP | 2.36 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |