C12H14N6OS — CID 175864789
2-(4-pyridazin-3-ylpiperazin-1-yl)-1,3-thiazole-5-carboxamide (PubChem CID 175864789) has the molecular formula C12H14N6OS and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-(4-pyridazin-3-ylpiperazin-1-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-pyridazin-3-ylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 175864789 |
| Molecular Formula | C12H14N6OS |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-(4-pyridazin-3-ylpiperazin-1-yl)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(N2CCN(c3cccnn3)CC2)s1 |
| InChI | InChI=1S/C12H14N6OS/c13-11(19)9-8-14-12(20-9)18-6-4-17(5-7-18)10-2-1-3-15-16-10/h1-3,8H,4-7H2,(H2,13,19) |
| InChIKey | GUBQAJWUWIOEOZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |