C7H10N4OS — CID 134429966
2-(3-aminoazetidin-1-yl)-1,3-thiazole-5-carboxamide (PubChem CID 134429966) has the molecular formula C7H10N4OS and a molecular weight of 198.25 g/mol. Its IUPAC name is 2-(3-aminoazetidin-1-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(3-aminoazetidin-1-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 134429966 |
| Molecular Formula | C7H10N4OS |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 2-(3-aminoazetidin-1-yl)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cnc(N2CC(N)C2)s1 |
| InChI | InChI=1S/C7H10N4OS/c8-4-2-11(3-4)7-10-1-5(13-7)6(9)12/h1,4H,2-3,8H2,(H2,9,12) |
| InChIKey | YMTZGCMKNHHVGB-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |