C18H24N6O2 — CID 175868876
5-methyl-3-[3-[2-[2-(methylamino)propanoylamino]ethyl]anilino]pyrazine-2-carboxamide (PubChem CID 175868876) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 5-methyl-3-[3-[2-[2-(methylamino)propanoylamino]ethyl]anilino]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-3-[3-[2-[2-(methylamino)propanoylamino]ethyl]anilino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 175868876 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 5-methyl-3-[3-[2-[2-(methylamino)propanoylamino]ethyl]anilino]pyrazine-2-carboxamide |
| SMILES | CNC(C)C(=O)NCCc1cccc(Nc2nc(C)cnc2C(N)=O)c1 |
| InChI | InChI=1S/C18H24N6O2/c1-11-10-22-15(16(19)25)17(23-11)24-14-6-4-5-13(9-14)7-8-21-18(26)12(2)20-3/h4-6,9-10,12,20H,7-8H2,1-3H3,(H2,19,25)(H,21,26)(H,23,24) |
| InChIKey | QMJCKDDOHZUPKP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |