C21H21FN2O6 — CID 175869728
2,2-diethoxyethyl 6-(4-fluorophenyl)-4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate (PubChem CID 175869728) has the molecular formula C21H21FN2O6 and a molecular weight of 416.41 g/mol. Its IUPAC name is 2,2-diethoxyethyl 6-(4-fluorophenyl)-4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate.
| Compound Name | 2,2-diethoxyethyl 6-(4-fluorophenyl)-4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 175869728 |
| Molecular Formula | C21H21FN2O6 |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2,2-diethoxyethyl 6-(4-fluorophenyl)-4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(COC(=O)c1c(O)c2cc(-c3ccc(F)cc3)cnc2[nH]c1=O)OCC |
| InChI | InChI=1S/C21H21FN2O6/c1-3-28-16(29-4-2)11-30-21(27)17-18(25)15-9-13(10-23-19(15)24-20(17)26)12-5-7-14(22)8-6-12/h5-10,16H,3-4,11H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | BRKWMLARWALDCV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|