C28H45F3N4O2SSi — CID 175873604
[[(S)-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[3-(2,2,2-trifluoroethyl)cyclobutyl]methyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 175873604) has the molecular formula C28H45F3N4O2SSi and a molecular weight of 586.84 g/mol. Its IUPAC name is [[(S)-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[3-(2,2,2-trifluoroethyl)cyclobutyl]methyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(S)-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[3-(2,2,2-trifluoroethyl)cyclobutyl]methyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 175873604 |
| Molecular Formula | C28H45F3N4O2SSi |
| Molecular Weight | 586.84 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | [[(S)-[6-[(R)-amino(cyclopropyl)methyl]-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]-[3-(2,2,2-trifluoroethyl)cyclobutyl]methyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@H](c1nc2ccc([C@H](N)C3CC3)cc2n1COCC[Si](C)(C)C)C1CC(CC(F)(F)F)C1 |
| InChI | InChI=1S/C28H45F3N4O2SSi/c1-27(2,3)38(36)34-25(21-13-18(14-21)16-28(29,30)31)26-33-22-10-9-20(24(32)19-7-8-19)15-23(22)35(26)17-37-11-12-39(4,5)6/h9-10,15,18-19,21,24-25,34H,7-8,11-14,16-17,32H2,1-6H3/t18?,21?,24-,25+,38?/m1/s1 |
| InChIKey | IAESDQRBIFXXIM-VRQMUUEHSA-N |
| XLogP | 6.83 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.84 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|