C25H24ClF3N2O — CID 175877172
N'-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylbenzenecarboximidamide (PubChem CID 175877172) has the molecular formula C25H24ClF3N2O and a molecular weight of 460.93 g/mol. Its IUPAC name is N'-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylbenzenecarboximidamide.
| Compound Name | N'-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 175877172 |
| Molecular Formula | C25H24ClF3N2O |
| Molecular Weight | 460.93 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | N'-[4-[4-chloro-3-(trifluoromethyl)phenoxy]-2,5-dimethylphenyl]-N-ethyl-N-methylbenzenecarboximidamide |
| SMILES | CCN(C)/C(=N\c1cc(C)c(Oc2ccc(Cl)c(C(F)(F)F)c2)cc1C)c1ccccc1 |
| InChI | InChI=1S/C25H24ClF3N2O/c1-5-31(4)24(18-9-7-6-8-10-18)30-22-13-17(3)23(14-16(22)2)32-19-11-12-21(26)20(15-19)25(27,28)29/h6-15H,5H2,1-4H3/b30-24- |
| InChIKey | VSDBRWPCNBXRKG-KRUMMXJUSA-N |
| XLogP | 7.80 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.93 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|