C17H17ClF3N3O — CID 25158782
N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-5-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 25158782) has the molecular formula C17H17ClF3N3O and a molecular weight of 371.79 g/mol. Its IUPAC name is N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-5-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-5-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 25158782 |
| Molecular Formula | C17H17ClF3N3O |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-5-methyl-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cnc(Oc2ccc(Cl)c(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C17H17ClF3N3O/c1-4-24(3)10-23-12-7-11(2)16(22-9-12)25-13-5-6-15(18)14(8-13)17(19,20)21/h5-10H,4H2,1-3H3/b23-10+ |
| InChIKey | DVKUNIYDTBXJGN-AUEPDCJTSA-N |
| XLogP | 5.47 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|