C11H12N2O3 — CID 175877986
methyl 1-methyl-7-(oxomethylidene)-5,6-dihydro-4H-indazole-3-carboxylate (PubChem CID 175877986) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is methyl 1-methyl-7-(oxomethylidene)-5,6-dihydro-4H-indazole-3-carboxylate.
| Compound Name | methyl 1-methyl-7-(oxomethylidene)-5,6-dihydro-4H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 175877986 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | methyl 1-methyl-7-(oxomethylidene)-5,6-dihydro-4H-indazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)c2c1CCCC2=C=O |
| InChI | InChI=1S/C11H12N2O3/c1-13-10-7(6-14)4-3-5-8(10)9(12-13)11(15)16-2/h3-5H2,1-2H3 |
| InChIKey | SGMOXQAUKVWUFM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|