C18H35OS+ — CID 175878724
1-[2-(3-methyldecoxy)ethyl]-3,4-dihydro-2H-thiopyran-1-ium (PubChem CID 175878724) has the molecular formula C18H35OS+ and a molecular weight of 299.54 g/mol. Its IUPAC name is 1-[2-(3-methyldecoxy)ethyl]-3,4-dihydro-2H-thiopyran-1-ium.
| Compound Name | 1-[2-(3-methyldecoxy)ethyl]-3,4-dihydro-2H-thiopyran-1-ium |
|---|---|
| PubChem CID | 175878724 |
| Molecular Formula | C18H35OS+ |
| Molecular Weight | 299.54 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 1-[2-(3-methyldecoxy)ethyl]-3,4-dihydro-2H-thiopyran-1-ium |
| SMILES | CCCCCCCC(C)CCOCC[S+]1C=CCCC1 |
| InChI | InChI=1S/C18H35OS/c1-3-4-5-6-8-11-18(2)12-13-19-14-17-20-15-9-7-10-16-20/h9,15,18H,3-8,10-14,16-17H2,1-2H3/q+1 |
| InChIKey | WMPAKZFBXXVQDV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|