C25H33NO6 — CID 175882282
5-(3,4-dimethoxyphenyl)-4-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-3-methylpentanoic acid (PubChem CID 175882282) has the molecular formula C25H33NO6 and a molecular weight of 443.54 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-4-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-3-methylpentanoic acid.
| Compound Name | 5-(3,4-dimethoxyphenyl)-4-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 175882282 |
| Molecular Formula | C25H33NO6 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-4-[(1R)-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]-3-methylpentanoic acid |
| SMILES | COc1ccc(CC(C(C)CC(=O)O)[C@H]2NCCc3cc(OC)c(OC)cc32)cc1OC |
| InChI | InChI=1S/C25H33NO6/c1-15(10-24(27)28)18(11-16-6-7-20(29-2)21(12-16)30-3)25-19-14-23(32-5)22(31-4)13-17(19)8-9-26-25/h6-7,12-15,18,25-26H,8-11H2,1-5H3,(H,27,28)/t15?,18?,25-/m1/s1 |
| InChIKey | ZAKGSVXRMIFTJA-HETURZAUSA-N |
| XLogP | 3.88 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |