C22H13NO10 — CID 175883929
[2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-nitrobenzoate (PubChem CID 175883929) has the molecular formula C22H13NO10 and a molecular weight of 451.34 g/mol. Its IUPAC name is [2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-nitrobenzoate.
| Compound Name | [2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 175883929 |
| Molecular Formula | C22H13NO10 |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | [2-hydroxy-4-(3,5,7-trihydroxy-4-oxochromen-2-yl)phenyl] 4-nitrobenzoate |
| SMILES | O=C(Oc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H13NO10/c24-13-8-15(26)18-17(9-13)32-21(20(28)19(18)27)11-3-6-16(14(25)7-11)33-22(29)10-1-4-12(5-2-10)23(30)31/h1-9,24-26,28H |
| InChIKey | MBEVLHRTLYXJPM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 180.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|