C27H30F6N4O — CID 175884151
(3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-[5-[1-(trifluoromethyl)cyclopropyl]-6-(2,4,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 175884151) has the molecular formula C27H30F6N4O and a molecular weight of 542.56 g/mol. Its IUPAC name is (3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-[5-[1-(trifluoromethyl)cyclopropyl]-6-(2,4,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-[5-[1-(trifluoromethyl)cyclopropyl]-6-(2,4,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 175884151 |
| Molecular Formula | C27H30F6N4O |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | (3aR,6aS)-2-[dideuterio(oxan-4-yl)methyl]-N-[5-[1-(trifluoromethyl)cyclopropyl]-6-(2,4,5-trifluorophenyl)pyridazin-3-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | [2H]C([2H])(C1CCOCC1)N1C[C@H]2CC(Nc3cc(C4(C(F)(F)F)CC4)c(-c4cc(F)c(F)cc4F)nn3)C[C@H]2C1 |
| InChI | InChI=1S/C27H30F6N4O/c28-21-11-23(30)22(29)9-19(21)25-20(26(3-4-26)27(31,32)33)10-24(35-36-25)34-18-7-16-13-37(14-17(16)8-18)12-15-1-5-38-6-2-15/h9-11,15-18H,1-8,12-14H2,(H,34,35)/t16-,17+,18?/i12D2 |
| InChIKey | PJOUODHIVLPIFW-JBELEVJQSA-N |
| XLogP | 5.70 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|