C17H16F6N4O4 — CID 175884951
N-[(3R,5R)-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 175884951) has the molecular formula C17H16F6N4O4 and a molecular weight of 454.33 g/mol. Its IUPAC name is N-[(3R,5R)-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(3R,5R)-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175884951 |
| Molecular Formula | C17H16F6N4O4 |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | N-[(3R,5R)-5-methylpyrrolidin-3-yl]-5-[3-(trifluoromethyl)phenyl]-1,3,4-oxadiazole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1C[C@@H](NC(=O)c2nnc(-c3cccc(C(F)(F)F)c3)o2)CN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H15F3N4O2.C2HF3O2/c1-8-5-11(7-19-8)20-12(23)14-22-21-13(24-14)9-3-2-4-10(6-9)15(16,17)18;3-2(4,5)1(6)7/h2-4,6,8,11,19H,5,7H2,1H3,(H,20,23);(H,6,7)/t8-,11-;/m1./s1 |
| InChIKey | DXHNILOBTVMLSG-JHQAJZDGSA-N |
| XLogP | 2.87 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |