C17H19N3O2SSi — CID 175889961
(5R)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2-trimethylsilylethynyl)imidazolidin-2-one (PubChem CID 175889961) has the molecular formula C17H19N3O2SSi and a molecular weight of 357.51 g/mol. Its IUPAC name is (5R)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2-trimethylsilylethynyl)imidazolidin-2-one.
| Compound Name | (5R)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2-trimethylsilylethynyl)imidazolidin-2-one |
|---|---|
| PubChem CID | 175889961 |
| Molecular Formula | C17H19N3O2SSi |
| Molecular Weight | 357.51 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (5R)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-5-(2-trimethylsilylethynyl)imidazolidin-2-one |
| SMILES | C[Si](C)(C)C#C[C@@H]1CNC(=O)N1c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C17H19N3O2SSi/c1-24(2,3)9-7-11-10-18-16(21)20(11)17-19-15-12-6-8-22-13(12)4-5-14(15)23-17/h4-5,11H,6,8,10H2,1-3H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | HSDOMRSVEGDFRR-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|