C17H17N5O2S — CID 177070937
2-[[(3aR,5S,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]amino]acetonitrile (PubChem CID 177070937) has the molecular formula C17H17N5O2S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[[(3aR,5S,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]amino]acetonitrile.
| Compound Name | 2-[[(3aR,5S,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 177070937 |
| Molecular Formula | C17H17N5O2S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-[[(3aR,5S,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]amino]acetonitrile |
| SMILES | N#CCN[C@H]1C[C@@H]2NC(=O)N(c3nc4c5c(ccc4s3)OCC5)[C@@H]2C1 |
| InChI | InChI=1S/C17H17N5O2S/c18-4-5-19-9-7-11-12(8-9)22(16(23)20-11)17-21-15-10-3-6-24-13(10)1-2-14(15)25-17/h1-2,9,11-12,19H,3,5-8H2,(H,20,23)/t9-,11-,12+/m0/s1 |
| InChIKey | DMIPELMDHIWSKM-ZMLRMANQSA-N |
| XLogP | 1.77 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|