C16H14N4O3S — CID 170519521
(3aR,6R,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-isocyano-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one (PubChem CID 170519521) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is (3aR,6R,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-isocyano-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one.
| Compound Name | (3aR,6R,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-isocyano-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one |
|---|---|
| PubChem CID | 170519521 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (3aR,6R,7aR)-1-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-6-isocyano-3,3a,4,6,7,7a-hexahydropyrano[3,4-d]imidazol-2-one |
| SMILES | [C-]#[N+][C@H]1C[C@@H]2[C@H](CO1)NC(=O)N2c1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C16H14N4O3S/c1-17-13-6-10-9(7-23-13)18-15(21)20(10)16-19-14-8-4-5-22-11(8)2-3-12(14)24-16/h2-3,9-10,13H,4-7H2,(H,18,21)/t9-,10+,13+/m0/s1 |
| InChIKey | RPJVVNUEMODIOG-OPQQBVKSSA-N |
| XLogP | 2.16 |
| TPSA | 68.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|