C20H24N4O4S — CID 177070929
tert-butyl N-[(3aR,5R,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]carbamate (PubChem CID 177070929) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]carbamate |
|---|---|
| PubChem CID | 177070929 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6aS)-3-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-yl)-2-oxo-1,3a,4,5,6,6a-hexahydrocyclopenta[d]imidazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H]2NC(=O)N(c3nc4c5c(ccc4s3)OCC5)[C@@H]2C1 |
| InChI | InChI=1S/C20H24N4O4S/c1-20(2,3)28-19(26)21-10-8-12-13(9-10)24(17(25)22-12)18-23-16-11-6-7-27-14(11)4-5-15(16)29-18/h4-5,10,12-13H,6-9H2,1-3H3,(H,21,26)(H,22,25)/t10-,12+,13-/m1/s1 |
| InChIKey | VSTPSICPPIWZBK-KGYLQXTDSA-N |
| XLogP | 3.19 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |