C21H25F3N4O4S — CID 175847135
tert-butyl N-[(1S,2R,5R)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-5-[(2,2,2-trifluoroacetyl)amino]cyclopentyl]carbamate (PubChem CID 175847135) has the molecular formula C21H25F3N4O4S and a molecular weight of 486.52 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,5R)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-5-[(2,2,2-trifluoroacetyl)amino]cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R,5R)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-5-[(2,2,2-trifluoroacetyl)amino]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 175847135 |
| Molecular Formula | C21H25F3N4O4S |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | tert-butyl N-[(1S,2R,5R)-2-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)-5-[(2,2,2-trifluoroacetyl)amino]cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@H](NC(=O)C(F)(F)F)CC[C@H]1Nc1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C21H25F3N4O4S/c1-20(2,3)32-19(30)28-16-11(25-17(29)21(22,23)24)4-5-12(16)26-18-27-15-10-8-9-31-13(10)6-7-14(15)33-18/h6-7,11-12,16H,4-5,8-9H2,1-3H3,(H,25,29)(H,26,27)(H,28,30)/t11-,12-,16+/m1/s1 |
| InChIKey | HGZZLZBRMWJRHF-HSMVNMDESA-N |
| XLogP | 3.75 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |