C21H27N3O3S — CID 175839331
tert-butyl N-[(2R,4R)-4-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)hept-5-yn-2-yl]carbamate (PubChem CID 175839331) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is tert-butyl N-[(2R,4R)-4-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)hept-5-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4R)-4-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)hept-5-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 175839331 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | tert-butyl N-[(2R,4R)-4-(7,8-dihydrofuro[3,2-e][1,3]benzothiazol-2-ylamino)hept-5-yn-2-yl]carbamate |
| SMILES | CC#C[C@@H](C[C@@H](C)NC(=O)OC(C)(C)C)Nc1nc2c3c(ccc2s1)OCC3 |
| InChI | InChI=1S/C21H27N3O3S/c1-6-7-14(12-13(2)22-20(25)27-21(3,4)5)23-19-24-18-15-10-11-26-16(15)8-9-17(18)28-19/h8-9,13-14H,10-12H2,1-5H3,(H,22,25)(H,23,24)/t13-,14+/m1/s1 |
| InChIKey | UXRGDWGJANWJOH-KGLIPLIRSA-N |
| XLogP | 4.34 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|